About 1,3-dichloro-2-fluorobenzene;molecular nitrogen;hydrofluoride
1,3-dichloro-2-fluorobenzene;molecular nitrogen;hydrofluoride (PubChem CID 174739801) has the molecular formula C6H4Cl2F2N2
and a molecular weight of 213.01 g/mol. Its IUPAC name is 1,3-dichloro-2-fluorobenzene;molecular nitrogen;hydrofluoride.
Molecular Properties
| Compound Name | 1,3-dichloro-2-fluorobenzene;molecular nitrogen;hydrofluoride |
| PubChem CID | 174739801 |
| Molecular Formula | C6H4Cl2F2N2 |
| Molecular Weight | 213.01 g/mol |
| Exact Mass | 211.97 |
| IUPAC Name | 1,3-dichloro-2-fluorobenzene;molecular nitrogen;hydrofluoride |
| SMILES | F.Fc1c(Cl)cccc1Cl.N#N |
| InChI | InChI=1S/C6H3Cl2F.FH.N2/c7-4-2-1-3-5(8)6(4)9;;1-2/h1-3H;1H; |
| InChIKey | KGBSKCRMVBJCDG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.01 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloro-2-fluorobenzene;molecular nitrogen;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-2-fluorobenzene;molecular nitrogen;hydrofluoride?
The IUPAC name of 1,3-dichloro-2-fluorobenzene;molecular nitrogen;hydrofluoride (CID 174739801) is 1,3-dichloro-2-fluorobenzene;molecular nitrogen;hydrofluoride.
What is the SMILES notation for 1,3-dichloro-2-fluorobenzene;molecular nitrogen;hydrofluoride?
The canonical SMILES for 1,3-dichloro-2-fluorobenzene;molecular nitrogen;hydrofluoride is F.Fc1c(Cl)cccc1Cl.N#N.
What is the InChIKey of 1,3-dichloro-2-fluorobenzene;molecular nitrogen;hydrofluoride?
The InChIKey is KGBSKCRMVBJCDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2F.FH.N2/c7-4-2-1-3-5(8)6(4)9;;1-2/h1-3H;1H;.
What are the key properties of 1,3-dichloro-2-fluorobenzene;molecular nitrogen;hydrofluoride?
1,3-dichloro-2-fluorobenzene;molecular nitrogen;hydrofluoride has a molecular weight of 213.01 g/mol, XLogP of 3.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-2-fluorobenzene;molecular nitrogen;hydrofluoride is sourced from PubChem (CID 174739801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).