About 1-chloro-2,3-difluorobenzene
1-chloro-2,3-difluorobenzene (PubChem CID 157449386) has the molecular formula C12H6Cl2F4
and a molecular weight of 297.08 g/mol. Its IUPAC name is 1-chloro-2,3-difluorobenzene.
Molecular Properties
| Compound Name | 1-chloro-2,3-difluorobenzene |
| PubChem CID | 157449386 |
| Molecular Formula | C12H6Cl2F4 |
| Molecular Weight | 297.08 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 1-chloro-2,3-difluorobenzene |
| SMILES | Fc1cccc(Cl)c1F.Fc1cccc(Cl)c1F |
| InChI | InChI=1S/2C6H3ClF2/c2*7-4-2-1-3-5(8)6(4)9/h2*1-3H |
| InChIKey | BSPUBWMKRJUUIK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.08 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2,3-difluorobenzene?
The IUPAC name of 1-chloro-2,3-difluorobenzene (CID 157449386) is 1-chloro-2,3-difluorobenzene.
What is the SMILES notation for 1-chloro-2,3-difluorobenzene?
The canonical SMILES for 1-chloro-2,3-difluorobenzene is Fc1cccc(Cl)c1F.Fc1cccc(Cl)c1F.
What is the InChIKey of 1-chloro-2,3-difluorobenzene?
The InChIKey is BSPUBWMKRJUUIK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H3ClF2/c2*7-4-2-1-3-5(8)6(4)9/h2*1-3H.
What are the key properties of 1-chloro-2,3-difluorobenzene?
1-chloro-2,3-difluorobenzene has a molecular weight of 297.08 g/mol, XLogP of 5.24, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2,3-difluorobenzene is sourced from PubChem (CID 157449386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).