C9H9ClF3N — CID 67610403
3-chloro-N,N-dimethyl-2-(trifluoromethyl)aniline (PubChem CID 67610403) has the molecular formula C9H9ClF3N and a molecular weight of 223.63 g/mol. Its IUPAC name is 3-chloro-N,N-dimethyl-2-(trifluoromethyl)aniline.
| Compound Name | 3-chloro-N,N-dimethyl-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 67610403 |
| Molecular Formula | C9H9ClF3N |
| Molecular Weight | 223.63 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 3-chloro-N,N-dimethyl-2-(trifluoromethyl)aniline |
| SMILES | CN(C)c1cccc(Cl)c1C(F)(F)F |
| InChI | InChI=1S/C9H9ClF3N/c1-14(2)7-5-3-4-6(10)8(7)9(11,12)13/h3-5H,1-2H3 |
| InChIKey | BUKXTNXJPWRMPX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.63 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |