C10H12ClN — CID 89041162
4-chloro-1-ethyl-2,3-dihydroindole (PubChem CID 89041162) has the molecular formula C10H12ClN and a molecular weight of 181.67 g/mol. Its IUPAC name is 4-chloro-1-ethyl-2,3-dihydroindole.
| Compound Name | 4-chloro-1-ethyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 89041162 |
| Molecular Formula | C10H12ClN |
| Molecular Weight | 181.67 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 4-chloro-1-ethyl-2,3-dihydroindole |
| SMILES | CCN1CCc2c(Cl)cccc21 |
| InChI | InChI=1S/C10H12ClN/c1-2-12-7-6-8-9(11)4-3-5-10(8)12/h3-5H,2,6-7H2,1H3 |
| InChIKey | KODBJCLHPJYTDC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.67 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |