C10H13N — CID 583485
1,2-dimethyl-2,3-dihydroindole (PubChem CID 583485) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 1,2-dimethyl-2,3-dihydroindole.
| Compound Name | 1,2-dimethyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 583485 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 1,2-dimethyl-2,3-dihydroindole |
| SMILES | CC1Cc2ccccc2N1C |
| InChI | InChI=1S/C10H13N/c1-8-7-9-5-3-4-6-10(9)11(8)2/h3-6,8H,7H2,1-2H3 |
| InChIKey | ZDOWGOCJXFRDOM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |