About N-ethyl-2-methylaniline
N-ethyl-2-methylaniline (PubChem CID 7201) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is N-ethyl-2-methylaniline.
Molecular Properties
| Compound Name | N-ethyl-2-methylaniline |
| PubChem CID | 7201 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | N-ethyl-2-methylaniline |
| SMILES | CCNc1ccccc1C |
| InChI | InChI=1S/C9H13N/c1-3-10-9-7-5-4-6-8(9)2/h4-7,10H,3H2,1-2H3 |
| InChIKey | MWOUGPLLVVEUMM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-methylaniline?
The IUPAC name of N-ethyl-2-methylaniline (CID 7201) is N-ethyl-2-methylaniline.
What is the SMILES notation for N-ethyl-2-methylaniline?
The canonical SMILES for N-ethyl-2-methylaniline is CCNc1ccccc1C.
What is the InChIKey of N-ethyl-2-methylaniline?
The InChIKey is MWOUGPLLVVEUMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N/c1-3-10-9-7-5-4-6-8(9)2/h4-7,10H,3H2,1-2H3.
What are the key properties of N-ethyl-2-methylaniline?
N-ethyl-2-methylaniline has a molecular weight of 135.21 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-methylaniline is sourced from PubChem (CID 7201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).