About N-Isopropylaniline
N-Isopropylaniline (PubChem CID 13032) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is N-propan-2-ylaniline.
Molecular Properties
| Compound Name | N-Isopropylaniline |
| PubChem CID | 13032 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | N-propan-2-ylaniline |
| SMILES | CC(C)NC1=CC=CC=C1 |
| InChI | InChI=1S/C9H13N/c1-8(2)10-9-6-4-3-5-7-9/h3-8,10H,1-2H3 |
| InChIKey | FRCFWPVMFJMNDP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 12.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | 82 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-Isopropylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-Isopropylaniline?
The IUPAC name of N-Isopropylaniline (CID 13032) is N-propan-2-ylaniline.
What is the SMILES notation for N-Isopropylaniline?
The canonical SMILES for N-Isopropylaniline is CC(C)NC1=CC=CC=C1.
What is the InChIKey of N-Isopropylaniline?
The InChIKey is FRCFWPVMFJMNDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N/c1-8(2)10-9-6-4-3-5-7-9/h3-8,10H,1-2H3.
What are the key properties of N-Isopropylaniline?
N-Isopropylaniline has a molecular weight of 135.21 g/mol, XLogP of 2.50, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-Isopropylaniline is sourced from PubChem (CID 13032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).