C8H10FN — CID 50998713
2-fluoro-N,3-dimethylaniline (PubChem CID 50998713) has the molecular formula C8H10FN and a molecular weight of 139.17 g/mol. Its IUPAC name is 2-fluoro-N,3-dimethylaniline.
| Compound Name | 2-fluoro-N,3-dimethylaniline |
|---|---|
| PubChem CID | 50998713 |
| Molecular Formula | C8H10FN |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | 2-fluoro-N,3-dimethylaniline |
| SMILES | CNc1cccc(C)c1F |
| InChI | InChI=1S/C8H10FN/c1-6-4-3-5-7(10-2)8(6)9/h3-5,10H,1-2H3 |
| InChIKey | DTUBDDHAZHNABD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |