C8H11FN2 — CID 69472911
3-fluoro-1-N,2-N-dimethylbenzene-1,2-diamine (PubChem CID 69472911) has the molecular formula C8H11FN2 and a molecular weight of 154.19 g/mol. Its IUPAC name is 3-fluoro-1-N,2-N-dimethylbenzene-1,2-diamine.
| Compound Name | 3-fluoro-1-N,2-N-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 69472911 |
| Molecular Formula | C8H11FN2 |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 3-fluoro-1-N,2-N-dimethylbenzene-1,2-diamine |
| SMILES | CNc1cccc(F)c1NC |
| InChI | InChI=1S/C8H11FN2/c1-10-7-5-3-4-6(9)8(7)11-2/h3-5,10-11H,1-2H3 |
| InChIKey | KCTHRGCLINAZQO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |