C8H11ClFN — CID 167737520
2-fluoro-N,6-dimethylaniline;hydrochloride (PubChem CID 167737520) has the molecular formula C8H11ClFN and a molecular weight of 175.63 g/mol. Its IUPAC name is 2-fluoro-N,6-dimethylaniline;hydrochloride.
| Compound Name | 2-fluoro-N,6-dimethylaniline;hydrochloride |
|---|---|
| PubChem CID | 167737520 |
| Molecular Formula | C8H11ClFN |
| Molecular Weight | 175.63 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 2-fluoro-N,6-dimethylaniline;hydrochloride |
| SMILES | CNc1c(C)cccc1F.Cl |
| InChI | InChI=1S/C8H10FN.ClH/c1-6-4-3-5-7(9)8(6)10-2;/h3-5,10H,1-2H3;1H |
| InChIKey | FQLWWRBKAIAYPW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.63 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |