C15H14F2N2O — CID 108991420
1-(2,6-difluorophenyl)-3-(2,6-dimethylphenyl)urea (PubChem CID 108991420) has the molecular formula C15H14F2N2O and a molecular weight of 276.29 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-(2,6-dimethylphenyl)urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 108991420 |
| Molecular Formula | C15H14F2N2O |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-(2,6-dimethylphenyl)urea |
| SMILES | Cc1cccc(C)c1NC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H14F2N2O/c1-9-5-3-6-10(2)13(9)18-15(20)19-14-11(16)7-4-8-12(14)17/h3-8H,1-2H3,(H2,18,19,20) |
| InChIKey | QJWZDJNHQNANKU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |