C13H11F2N3O — CID 43469078
1-(4-aminophenyl)-3-(2,6-difluorophenyl)urea (PubChem CID 43469078) has the molecular formula C13H11F2N3O and a molecular weight of 263.25 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-(2,6-difluorophenyl)urea.
| Compound Name | 1-(4-aminophenyl)-3-(2,6-difluorophenyl)urea |
|---|---|
| PubChem CID | 43469078 |
| Molecular Formula | C13H11F2N3O |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 1-(4-aminophenyl)-3-(2,6-difluorophenyl)urea |
| SMILES | Nc1ccc(NC(=O)Nc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C13H11F2N3O/c14-10-2-1-3-11(15)12(10)18-13(19)17-9-6-4-8(16)5-7-9/h1-7H,16H2,(H2,17,18,19) |
| InChIKey | IMNHKFDSFWCAIW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|