C15H14F2N2O2 — CID 108874314
1-(2,6-difluorophenyl)-3-(4-ethoxyphenyl)urea (PubChem CID 108874314) has the molecular formula C15H14F2N2O2 and a molecular weight of 292.29 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-(4-ethoxyphenyl)urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-(4-ethoxyphenyl)urea |
|---|---|
| PubChem CID | 108874314 |
| Molecular Formula | C15H14F2N2O2 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-(4-ethoxyphenyl)urea |
| SMILES | CCOc1ccc(NC(=O)Nc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C15H14F2N2O2/c1-2-21-11-8-6-10(7-9-11)18-15(20)19-14-12(16)4-3-5-13(14)17/h3-9H,2H2,1H3,(H2,18,19,20) |
| InChIKey | XGQWAYINTCLPRJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |