C14H11ClF2N2O — CID 108991867
1-(3-chloro-4-methylphenyl)-3-(2,6-difluorophenyl)urea (PubChem CID 108991867) has the molecular formula C14H11ClF2N2O and a molecular weight of 296.70 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-(2,6-difluorophenyl)urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-(2,6-difluorophenyl)urea |
|---|---|
| PubChem CID | 108991867 |
| Molecular Formula | C14H11ClF2N2O |
| Molecular Weight | 296.70 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-(2,6-difluorophenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2c(F)cccc2F)cc1Cl |
| InChI | InChI=1S/C14H11ClF2N2O/c1-8-5-6-9(7-10(8)15)18-14(20)19-13-11(16)3-2-4-12(13)17/h2-7H,1H3,(H2,18,19,20) |
| InChIKey | WRXFUYVAARARAF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.70 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |