C10H16N2O — CID 173220801
3-ethoxy-1-N,2-N-dimethylbenzene-1,2-diamine (PubChem CID 173220801) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-ethoxy-1-N,2-N-dimethylbenzene-1,2-diamine.
| Compound Name | 3-ethoxy-1-N,2-N-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 173220801 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3-ethoxy-1-N,2-N-dimethylbenzene-1,2-diamine |
| SMILES | CCOc1cccc(NC)c1NC |
| InChI | InChI=1S/C10H16N2O/c1-4-13-9-7-5-6-8(11-2)10(9)12-3/h5-7,11-12H,4H2,1-3H3 |
| InChIKey | KKYORBZXLAZRNM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |