C13H21NO2 — CID 163819596
3,5-diethoxy-N,2,4-trimethylaniline (PubChem CID 163819596) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 3,5-diethoxy-N,2,4-trimethylaniline.
| Compound Name | 3,5-diethoxy-N,2,4-trimethylaniline |
|---|---|
| PubChem CID | 163819596 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 3,5-diethoxy-N,2,4-trimethylaniline |
| SMILES | CCOc1cc(NC)c(C)c(OCC)c1C |
| InChI | InChI=1S/C13H21NO2/c1-6-15-12-8-11(14-5)9(3)13(10(12)4)16-7-2/h8,14H,6-7H2,1-5H3 |
| InChIKey | NUGKQCOYAOSYQK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |