About 2,4-dichloro-1,5-diethoxy-3-methylbenzene
2,4-dichloro-1,5-diethoxy-3-methylbenzene (PubChem CID 90436867) has the molecular formula C11H14Cl2O2
and a molecular weight of 249.14 g/mol. Its IUPAC name is 2,4-dichloro-1,5-diethoxy-3-methylbenzene.
Molecular Properties
| Compound Name | 2,4-dichloro-1,5-diethoxy-3-methylbenzene |
| PubChem CID | 90436867 |
| Molecular Formula | C11H14Cl2O2 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 2,4-dichloro-1,5-diethoxy-3-methylbenzene |
| SMILES | CCOc1cc(OCC)c(Cl)c(C)c1Cl |
| InChI | InChI=1S/C11H14Cl2O2/c1-4-14-8-6-9(15-5-2)11(13)7(3)10(8)12/h6H,4-5H2,1-3H3 |
| InChIKey | FNUFOABHQQQPKZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dichloro-1,5-diethoxy-3-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-1,5-diethoxy-3-methylbenzene?
The IUPAC name of 2,4-dichloro-1,5-diethoxy-3-methylbenzene (CID 90436867) is 2,4-dichloro-1,5-diethoxy-3-methylbenzene.
What is the SMILES notation for 2,4-dichloro-1,5-diethoxy-3-methylbenzene?
The canonical SMILES for 2,4-dichloro-1,5-diethoxy-3-methylbenzene is CCOc1cc(OCC)c(Cl)c(C)c1Cl.
What is the InChIKey of 2,4-dichloro-1,5-diethoxy-3-methylbenzene?
The InChIKey is FNUFOABHQQQPKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14Cl2O2/c1-4-14-8-6-9(15-5-2)11(13)7(3)10(8)12/h6H,4-5H2,1-3H3.
What are the key properties of 2,4-dichloro-1,5-diethoxy-3-methylbenzene?
2,4-dichloro-1,5-diethoxy-3-methylbenzene has a molecular weight of 249.14 g/mol, XLogP of 4.10, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-1,5-diethoxy-3-methylbenzene is sourced from PubChem (CID 90436867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).