C50H60O10 — CID 102460530
3,7,11,15,19,21,23,25,27,29-decaethoxyhexacyclo[16.2.2.22,5.26,9.210,13.214,17]triaconta-1(20),2(30),3,5(29),6(28),7,9(27),10(26),11,13(25),14,16,18,21,23-pentadecaene (PubChem CID 102460530) has the molecular formula C50H60O10 and a molecular weight of 821.02 g/mol. Its IUPAC name is 3,7,11,15,19,21,23,25,27,29-decaethoxyhexacyclo[16.2.2.22,5.26,9.210,13.214,17]triaconta-1(20),2(30),3,5(29),6(28),7,9(27),10(26),11,13(25),14,16,18,21,23-pentadecaene.
| Compound Name | 3,7,11,15,19,21,23,25,27,29-decaethoxyhexacyclo[16.2.2.22,5.26,9.210,13.214,17]triaconta-1(20),2(30),3,5(29),6(28),7,9(27),10(26),11,13(25),14,16,18,21,23-pentadecaene |
|---|---|
| PubChem CID | 102460530 |
| Molecular Formula | C50H60O10 |
| Molecular Weight | 821.02 g/mol |
| Exact Mass | 820.42 |
| IUPAC Name | 3,7,11,15,19,21,23,25,27,29-decaethoxyhexacyclo[16.2.2.22,5.26,9.210,13.214,17]triaconta-1(20),2(30),3,5(29),6(28),7,9(27),10(26),11,13(25),14,16,18,21,23-pentadecaene |
| SMILES | CCOc1cc2c(OCC)cc1-c1cc(OCC)c(cc1OCC)-c1cc(OCC)c(cc1OCC)-c1cc(OCC)c(cc1OCC)-c1cc(OCC)c-2cc1OCC |
| InChI | InChI=1S/C50H60O10/c1-11-51-41-21-32-34-24-46(56-16-6)36(26-45(34)55-15-5)38-28-50(60-20-10)40(30-49(38)59-19-9)39-29-47(57-17-7)37(27-48(39)58-18-8)35-25-43(53-13-3)33(23-44(35)54-14-4)31(41)22-42(32)52-12-2/h21-30H,11-20H2,1-10H3/b33-31-,34-32-,37-35+,38-36+,40-39+ |
| InChIKey | TUQKHBTVBMMSLG-HXDFPSFXSA-N |
| XLogP | 12.32 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.02 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |