C12H16Br2O2 — CID 22590203
1,4-bis(bromomethyl)-2,5-diethoxybenzene (PubChem CID 22590203) has the molecular formula C12H16Br2O2 and a molecular weight of 352.07 g/mol. Its IUPAC name is 1,4-bis(bromomethyl)-2,5-diethoxybenzene.
| Compound Name | 1,4-bis(bromomethyl)-2,5-diethoxybenzene |
|---|---|
| PubChem CID | 22590203 |
| Molecular Formula | C12H16Br2O2 |
| Molecular Weight | 352.07 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | 1,4-bis(bromomethyl)-2,5-diethoxybenzene |
| SMILES | CCOc1cc(CBr)c(OCC)cc1CBr |
| InChI | InChI=1S/C12H16Br2O2/c1-3-15-11-5-10(8-14)12(16-4-2)6-9(11)7-13/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | YRNMZQAVHCIKKW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.07 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|