About 3,5-diethoxypyridine-2,6-diamine;dihydrochloride
3,5-diethoxypyridine-2,6-diamine;dihydrochloride (PubChem CID 70442489) has the molecular formula C9H17Cl2N3O2
and a molecular weight of 270.16 g/mol. Its IUPAC name is 3,5-diethoxypyridine-2,6-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 3,5-diethoxypyridine-2,6-diamine;dihydrochloride |
| PubChem CID | 70442489 |
| Molecular Formula | C9H17Cl2N3O2 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 3,5-diethoxypyridine-2,6-diamine;dihydrochloride |
| SMILES | CCOc1cc(OCC)c(N)nc1N.Cl.Cl |
| InChI | InChI=1S/C9H15N3O2.2ClH/c1-3-13-6-5-7(14-4-2)9(11)12-8(6)10;;/h5H,3-4H2,1-2H3,(H4,10,11,12);2*1H |
| InChIKey | NPKZLPYPEOAWTO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,5-diethoxypyridine-2,6-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethoxypyridine-2,6-diamine;dihydrochloride?
The IUPAC name of 3,5-diethoxypyridine-2,6-diamine;dihydrochloride (CID 70442489) is 3,5-diethoxypyridine-2,6-diamine;dihydrochloride.
What is the SMILES notation for 3,5-diethoxypyridine-2,6-diamine;dihydrochloride?
The canonical SMILES for 3,5-diethoxypyridine-2,6-diamine;dihydrochloride is CCOc1cc(OCC)c(N)nc1N.Cl.Cl.
What is the InChIKey of 3,5-diethoxypyridine-2,6-diamine;dihydrochloride?
The InChIKey is NPKZLPYPEOAWTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2.2ClH/c1-3-13-6-5-7(14-4-2)9(11)12-8(6)10;;/h5H,3-4H2,1-2H3,(H4,10,11,12);2*1H.
What are the key properties of 3,5-diethoxypyridine-2,6-diamine;dihydrochloride?
3,5-diethoxypyridine-2,6-diamine;dihydrochloride has a molecular weight of 270.16 g/mol, XLogP of 1.89, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethoxypyridine-2,6-diamine;dihydrochloride is sourced from PubChem (CID 70442489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).