About 3-ethoxypyridin-2-amine
3-ethoxypyridin-2-amine (PubChem CID 586630) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 3-ethoxypyridin-2-amine.
Molecular Properties
| Compound Name | 3-ethoxypyridin-2-amine |
| PubChem CID | 586630 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 3-ethoxypyridin-2-amine |
| SMILES | CCOc1cccnc1N |
| InChI | InChI=1S/C7H10N2O/c1-2-10-6-4-3-5-9-7(6)8/h3-5H,2H2,1H3,(H2,8,9) |
| InChIKey | ASJVXZBTTFDZDW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethoxypyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxypyridin-2-amine?
The IUPAC name of 3-ethoxypyridin-2-amine (CID 586630) is 3-ethoxypyridin-2-amine.
What is the SMILES notation for 3-ethoxypyridin-2-amine?
The canonical SMILES for 3-ethoxypyridin-2-amine is CCOc1cccnc1N.
What is the InChIKey of 3-ethoxypyridin-2-amine?
The InChIKey is ASJVXZBTTFDZDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-2-10-6-4-3-5-9-7(6)8/h3-5H,2H2,1H3,(H2,8,9).
What are the key properties of 3-ethoxypyridin-2-amine?
3-ethoxypyridin-2-amine has a molecular weight of 138.17 g/mol, XLogP of 1.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxypyridin-2-amine is sourced from PubChem (CID 586630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).