C10H14ClNO — CID 82053344
3-chloro-6-ethoxy-2,4-dimethylaniline (PubChem CID 82053344) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is 3-chloro-6-ethoxy-2,4-dimethylaniline.
| Compound Name | 3-chloro-6-ethoxy-2,4-dimethylaniline |
|---|---|
| PubChem CID | 82053344 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 3-chloro-6-ethoxy-2,4-dimethylaniline |
| SMILES | CCOc1cc(C)c(Cl)c(C)c1N |
| InChI | InChI=1S/C10H14ClNO/c1-4-13-8-5-6(2)9(11)7(3)10(8)12/h5H,4,12H2,1-3H3 |
| InChIKey | DHXUWPOSDTZITA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|