C15H23ClO3 — CID 83937949
5-(3-chloro-6-ethoxy-2,4-dimethylphenyl)pentane-2,3-diol (PubChem CID 83937949) has the molecular formula C15H23ClO3 and a molecular weight of 286.80 g/mol. Its IUPAC name is 5-(3-chloro-6-ethoxy-2,4-dimethylphenyl)pentane-2,3-diol.
| Compound Name | 5-(3-chloro-6-ethoxy-2,4-dimethylphenyl)pentane-2,3-diol |
|---|---|
| PubChem CID | 83937949 |
| Molecular Formula | C15H23ClO3 |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 5-(3-chloro-6-ethoxy-2,4-dimethylphenyl)pentane-2,3-diol |
| SMILES | CCOc1cc(C)c(Cl)c(C)c1CCC(O)C(C)O |
| InChI | InChI=1S/C15H23ClO3/c1-5-19-14-8-9(2)15(16)10(3)12(14)6-7-13(18)11(4)17/h8,11,13,17-18H,5-7H2,1-4H3 |
| InChIKey | YDZRPWMPJJBJSU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |