C15H24ClNO2 — CID 83940663
4-amino-1-(5-chloro-2-ethoxy-3,6-dimethylphenyl)pentan-3-ol (PubChem CID 83940663) has the molecular formula C15H24ClNO2 and a molecular weight of 285.82 g/mol. Its IUPAC name is 4-amino-1-(5-chloro-2-ethoxy-3,6-dimethylphenyl)pentan-3-ol.
| Compound Name | 4-amino-1-(5-chloro-2-ethoxy-3,6-dimethylphenyl)pentan-3-ol |
|---|---|
| PubChem CID | 83940663 |
| Molecular Formula | C15H24ClNO2 |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 4-amino-1-(5-chloro-2-ethoxy-3,6-dimethylphenyl)pentan-3-ol |
| SMILES | CCOc1c(C)cc(Cl)c(C)c1CCC(O)C(C)N |
| InChI | InChI=1S/C15H24ClNO2/c1-5-19-15-9(2)8-13(16)10(3)12(15)6-7-14(18)11(4)17/h8,11,14,18H,5-7,17H2,1-4H3 |
| InChIKey | RNCZRSAXXRIVOW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |