C16H23ClO2 — CID 83940660
2-[1-(5-chloro-2-ethoxy-3,6-dimethylphenyl)propan-2-yl]-3-methyloxirane (PubChem CID 83940660) has the molecular formula C16H23ClO2 and a molecular weight of 282.81 g/mol. Its IUPAC name is 2-[1-(5-chloro-2-ethoxy-3,6-dimethylphenyl)propan-2-yl]-3-methyloxirane.
| Compound Name | 2-[1-(5-chloro-2-ethoxy-3,6-dimethylphenyl)propan-2-yl]-3-methyloxirane |
|---|---|
| PubChem CID | 83940660 |
| Molecular Formula | C16H23ClO2 |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-[1-(5-chloro-2-ethoxy-3,6-dimethylphenyl)propan-2-yl]-3-methyloxirane |
| SMILES | CCOc1c(C)cc(Cl)c(C)c1CC(C)C1OC1C |
| InChI | InChI=1S/C16H23ClO2/c1-6-18-16-10(3)8-14(17)11(4)13(16)7-9(2)15-12(5)19-15/h8-9,12,15H,6-7H2,1-5H3 |
| InChIKey | PSMDHPRNGDHZFN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|