C11H13ClO2 — CID 171085182
3-chloro-2-ethoxy-5,6-dimethylbenzaldehyde (PubChem CID 171085182) has the molecular formula C11H13ClO2 and a molecular weight of 212.68 g/mol. Its IUPAC name is 3-chloro-2-ethoxy-5,6-dimethylbenzaldehyde.
| Compound Name | 3-chloro-2-ethoxy-5,6-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 171085182 |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 3-chloro-2-ethoxy-5,6-dimethylbenzaldehyde |
| SMILES | CCOc1c(Cl)cc(C)c(C)c1C=O |
| InChI | InChI=1S/C11H13ClO2/c1-4-14-11-9(6-13)8(3)7(2)5-10(11)12/h5-6H,4H2,1-3H3 |
| InChIKey | FEEWVEDECAPEKZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|