C10H13ClO — CID 143804425
1-chloro-2-ethoxy-3,4-dimethylbenzene (PubChem CID 143804425) has the molecular formula C10H13ClO and a molecular weight of 184.67 g/mol. Its IUPAC name is 1-chloro-2-ethoxy-3,4-dimethylbenzene.
| Compound Name | 1-chloro-2-ethoxy-3,4-dimethylbenzene |
|---|---|
| PubChem CID | 143804425 |
| Molecular Formula | C10H13ClO |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1-chloro-2-ethoxy-3,4-dimethylbenzene |
| SMILES | CCOc1c(Cl)ccc(C)c1C |
| InChI | InChI=1S/C10H13ClO/c1-4-12-10-8(3)7(2)5-6-9(10)11/h5-6H,4H2,1-3H3 |
| InChIKey | CIQRYILGCMTGPO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |