C12H19ClNO+ — CID 2199183
3-(6-chloro-2,3-dimethylphenoxy)propyl-methylazanium (PubChem CID 2199183) has the molecular formula C12H19ClNO+ and a molecular weight of 228.74 g/mol. Its IUPAC name is 3-(6-chloro-2,3-dimethylphenoxy)propyl-methylazanium.
| Compound Name | 3-(6-chloro-2,3-dimethylphenoxy)propyl-methylazanium |
|---|---|
| PubChem CID | 2199183 |
| Molecular Formula | C12H19ClNO+ |
| Molecular Weight | 228.74 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 3-(6-chloro-2,3-dimethylphenoxy)propyl-methylazanium |
| SMILES | C[NH2+]CCCOc1c(Cl)ccc(C)c1C |
| InChI | InChI=1S/C12H18ClNO/c1-9-5-6-11(13)12(10(9)2)15-8-4-7-14-3/h5-6,14H,4,7-8H2,1-3H3/p+1 |
| InChIKey | TXQXNZBKODLRDD-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.74 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|