C16H25ClNO+ — CID 2199624
3-(2-chloro-3,6-dimethylphenoxy)propyl-cyclopentylazanium (PubChem CID 2199624) has the molecular formula C16H25ClNO+ and a molecular weight of 282.83 g/mol. Its IUPAC name is 3-(2-chloro-3,6-dimethylphenoxy)propyl-cyclopentylazanium.
| Compound Name | 3-(2-chloro-3,6-dimethylphenoxy)propyl-cyclopentylazanium |
|---|---|
| PubChem CID | 2199624 |
| Molecular Formula | C16H25ClNO+ |
| Molecular Weight | 282.83 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 3-(2-chloro-3,6-dimethylphenoxy)propyl-cyclopentylazanium |
| SMILES | Cc1ccc(C)c(OCCC[NH2+]C2CCCC2)c1Cl |
| InChI | InChI=1S/C16H24ClNO/c1-12-8-9-13(2)16(15(12)17)19-11-5-10-18-14-6-3-4-7-14/h8-9,14,18H,3-7,10-11H2,1-2H3/p+1 |
| InChIKey | FHARAVGLHKKBGV-UHFFFAOYSA-O |
| XLogP | 3.23 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.83 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|