C16H26NO2+ — CID 7473347
cyclopentyl-[(2S)-3-(3,4-dimethylphenoxy)-2-hydroxypropyl]azanium (PubChem CID 7473347) has the molecular formula C16H26NO2+ and a molecular weight of 264.39 g/mol. Its IUPAC name is cyclopentyl-[(2S)-3-(3,4-dimethylphenoxy)-2-hydroxypropyl]azanium.
| Compound Name | cyclopentyl-[(2S)-3-(3,4-dimethylphenoxy)-2-hydroxypropyl]azanium |
|---|---|
| PubChem CID | 7473347 |
| Molecular Formula | C16H26NO2+ |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | cyclopentyl-[(2S)-3-(3,4-dimethylphenoxy)-2-hydroxypropyl]azanium |
| SMILES | Cc1ccc(OC[C@@H](O)C[NH2+]C2CCCC2)cc1C |
| InChI | InChI=1S/C16H25NO2/c1-12-7-8-16(9-13(12)2)19-11-15(18)10-17-14-5-3-4-6-14/h7-9,14-15,17-18H,3-6,10-11H2,1-2H3/p+1/t15-/m0/s1 |
| InChIKey | IOPMSOCYEHUKKP-HNNXBMFYSA-O |
| XLogP | 1.55 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |