C24H32NO3+ — CID 2102085
[(2R)-3-(4-benzoylphenoxy)-2-hydroxypropyl]-cyclooctylazanium (PubChem CID 2102085) has the molecular formula C24H32NO3+ and a molecular weight of 382.52 g/mol. Its IUPAC name is [(2R)-3-(4-benzoylphenoxy)-2-hydroxypropyl]-cyclooctylazanium.
| Compound Name | [(2R)-3-(4-benzoylphenoxy)-2-hydroxypropyl]-cyclooctylazanium |
|---|---|
| PubChem CID | 2102085 |
| Molecular Formula | C24H32NO3+ |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | [(2R)-3-(4-benzoylphenoxy)-2-hydroxypropyl]-cyclooctylazanium |
| SMILES | O=C(c1ccccc1)c1ccc(OC[C@H](O)C[NH2+]C2CCCCCCC2)cc1 |
| InChI | InChI=1S/C24H31NO3/c26-22(17-25-21-11-7-2-1-3-8-12-21)18-28-23-15-13-20(14-16-23)24(27)19-9-5-4-6-10-19/h4-6,9-10,13-16,21-22,25-26H,1-3,7-8,11-12,17-18H2/p+1/t22-/m1/s1 |
| InChIKey | FOTNOSZTKHTRLJ-JOCHJYFZSA-O |
| XLogP | 3.33 |
| TPSA | 63.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |