C33H36ClNO4 — CID 158757358
chloromethane;[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-phenylmethanone;(4-methylphenyl)-phenylmethanone (PubChem CID 158757358) has the molecular formula C33H36ClNO4 and a molecular weight of 546.11 g/mol. Its IUPAC name is chloromethane;[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-phenylmethanone;(4-methylphenyl)-phenylmethanone.
| Compound Name | chloromethane;[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-phenylmethanone;(4-methylphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 158757358 |
| Molecular Formula | C33H36ClNO4 |
| Molecular Weight | 546.11 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | chloromethane;[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-phenylmethanone;(4-methylphenyl)-phenylmethanone |
| SMILES | CCl.CN(C)CC(O)COc1ccc(C(=O)c2ccccc2)cc1.Cc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H21NO3.C14H12O.CH3Cl/c1-19(2)12-16(20)13-22-17-10-8-15(9-11-17)18(21)14-6-4-3-5-7-14;1-11-7-9-13(10-8-11)14(15)12-5-3-2-4-6-12;1-2/h3-11,16,20H,12-13H2,1-2H3;2-10H,1H3;1H3 |
| InChIKey | IOFVGWHZLQTZHB-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.11 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|