C19H26ClNO4 — CID 66916242
chloromethane;[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-phenylmethanone;hydrate (PubChem CID 66916242) has the molecular formula C19H26ClNO4 and a molecular weight of 367.87 g/mol. Its IUPAC name is chloromethane;[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-phenylmethanone;hydrate.
| Compound Name | chloromethane;[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-phenylmethanone;hydrate |
|---|---|
| PubChem CID | 66916242 |
| Molecular Formula | C19H26ClNO4 |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | chloromethane;[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-phenylmethanone;hydrate |
| SMILES | CCl.CN(C)CC(O)COc1ccc(C(=O)c2ccccc2)cc1.O |
| InChI | InChI=1S/C18H21NO3.CH3Cl.H2O/c1-19(2)12-16(20)13-22-17-10-8-15(9-11-17)18(21)14-6-4-3-5-7-14;1-2;/h3-11,16,20H,12-13H2,1-2H3;1H3;1H2 |
| InChIKey | ZPDDOSHGHWGXHT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 81.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|