C21H28O2 — CID 143798927
ethane;[4-(2-ethylbutoxy)phenyl]-phenylmethanone (PubChem CID 143798927) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is ethane;[4-(2-ethylbutoxy)phenyl]-phenylmethanone.
| Compound Name | ethane;[4-(2-ethylbutoxy)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 143798927 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | ethane;[4-(2-ethylbutoxy)phenyl]-phenylmethanone |
| SMILES | CC.CCC(CC)COc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H22O2.C2H6/c1-3-15(4-2)14-21-18-12-10-17(11-13-18)19(20)16-8-6-5-7-9-16;1-2/h5-13,15H,3-4,14H2,1-2H3;1-2H3 |
| InChIKey | FQRYQGRWBBUCCF-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |