C28H38O — CID 59296842
1-[(2E,4E)-3,4-dimethyl-5-phenylhexa-2,4-dien-2-yl]-4-(2-ethylhexoxy)benzene (PubChem CID 59296842) has the molecular formula C28H38O and a molecular weight of 390.61 g/mol. Its IUPAC name is 1-[(2E,4E)-3,4-dimethyl-5-phenylhexa-2,4-dien-2-yl]-4-(2-ethylhexoxy)benzene.
| Compound Name | 1-[(2E,4E)-3,4-dimethyl-5-phenylhexa-2,4-dien-2-yl]-4-(2-ethylhexoxy)benzene |
|---|---|
| PubChem CID | 59296842 |
| Molecular Formula | C28H38O |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | 1-[(2E,4E)-3,4-dimethyl-5-phenylhexa-2,4-dien-2-yl]-4-(2-ethylhexoxy)benzene |
| SMILES | CCCCC(CC)COc1ccc(/C(C)=C(C)/C(C)=C(\C)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H38O/c1-7-9-13-25(8-2)20-29-28-18-16-27(17-19-28)24(6)22(4)21(3)23(5)26-14-11-10-12-15-26/h10-12,14-19,25H,7-9,13,20H2,1-6H3/b23-21+,24-22+ |
| InChIKey | BTAYHKFYDWHFMV-MBALSZOMSA-N |
| XLogP | 8.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|