About 2-ethylhexoxybenzene;methoxyboronic acid
2-ethylhexoxybenzene;methoxyboronic acid (PubChem CID 23293414) has the molecular formula C15H27BO4
and a molecular weight of 282.19 g/mol. Its IUPAC name is 2-ethylhexoxybenzene;methoxyboronic acid.
Molecular Properties
| Compound Name | 2-ethylhexoxybenzene;methoxyboronic acid |
| PubChem CID | 23293414 |
| Molecular Formula | C15H27BO4 |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 2-ethylhexoxybenzene;methoxyboronic acid |
| SMILES | CCCCC(CC)COc1ccccc1.COB(O)O |
| InChI | InChI=1S/C14H22O.CH5BO3/c1-3-5-9-13(4-2)12-15-14-10-7-6-8-11-14;1-5-2(3)4/h6-8,10-11,13H,3-5,9,12H2,1-2H3;3-4H,1H3 |
| InChIKey | FXDHRPYLZXXMOP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexoxybenzene;methoxyboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexoxybenzene;methoxyboronic acid?
The IUPAC name of 2-ethylhexoxybenzene;methoxyboronic acid (CID 23293414) is 2-ethylhexoxybenzene;methoxyboronic acid.
What is the SMILES notation for 2-ethylhexoxybenzene;methoxyboronic acid?
The canonical SMILES for 2-ethylhexoxybenzene;methoxyboronic acid is CCCCC(CC)COc1ccccc1.COB(O)O.
What is the InChIKey of 2-ethylhexoxybenzene;methoxyboronic acid?
The InChIKey is FXDHRPYLZXXMOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O.CH5BO3/c1-3-5-9-13(4-2)12-15-14-10-7-6-8-11-14;1-5-2(3)4/h6-8,10-11,13H,3-5,9,12H2,1-2H3;3-4H,1H3.
What are the key properties of 2-ethylhexoxybenzene;methoxyboronic acid?
2-ethylhexoxybenzene;methoxyboronic acid has a molecular weight of 282.19 g/mol, XLogP of 2.88, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexoxybenzene;methoxyboronic acid is sourced from PubChem (CID 23293414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).