C23H40O5 — CID 162495095
[3-(2-ethylhexoxy)-2-[2-(2-methoxypropoxy)ethoxy]propoxy]benzene (PubChem CID 162495095) has the molecular formula C23H40O5 and a molecular weight of 396.57 g/mol. Its IUPAC name is [3-(2-ethylhexoxy)-2-[2-(2-methoxypropoxy)ethoxy]propoxy]benzene.
| Compound Name | [3-(2-ethylhexoxy)-2-[2-(2-methoxypropoxy)ethoxy]propoxy]benzene |
|---|---|
| PubChem CID | 162495095 |
| Molecular Formula | C23H40O5 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | [3-(2-ethylhexoxy)-2-[2-(2-methoxypropoxy)ethoxy]propoxy]benzene |
| SMILES | CCCCC(CC)COCC(COc1ccccc1)OCCOCC(C)OC |
| InChI | InChI=1S/C23H40O5/c1-5-7-11-21(6-2)17-26-18-23(19-28-22-12-9-8-10-13-22)27-15-14-25-16-20(3)24-4/h8-10,12-13,20-21,23H,5-7,11,14-19H2,1-4H3 |
| InChIKey | YMXAPPMHXRTBSE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|