C32H55NO5 — CID 166881129
2-[3-[1-(2-ethylhexoxy)-3-phenoxypropan-2-yl]oxy-3-methylbutoxy]-5-[(2-methylpropan-2-yl)oxy]hex-1-en-3-imine (PubChem CID 166881129) has the molecular formula C32H55NO5 and a molecular weight of 533.79 g/mol. Its IUPAC name is 2-[3-[1-(2-ethylhexoxy)-3-phenoxypropan-2-yl]oxy-3-methylbutoxy]-5-[(2-methylpropan-2-yl)oxy]hex-1-en-3-imine.
| Compound Name | 2-[3-[1-(2-ethylhexoxy)-3-phenoxypropan-2-yl]oxy-3-methylbutoxy]-5-[(2-methylpropan-2-yl)oxy]hex-1-en-3-imine |
|---|---|
| PubChem CID | 166881129 |
| Molecular Formula | C32H55NO5 |
| Molecular Weight | 533.79 g/mol |
| Exact Mass | 533.41 |
| IUPAC Name | 2-[3-[1-(2-ethylhexoxy)-3-phenoxypropan-2-yl]oxy-3-methylbutoxy]-5-[(2-methylpropan-2-yl)oxy]hex-1-en-3-imine |
| SMILES | [H]/N=C(\CC(C)OC(C)(C)C)C(=C)OCCC(C)(C)OC(COCC(CC)CCCC)COc1ccccc1 |
| InChI | InChI=1S/C32H55NO5/c1-10-12-16-27(11-2)22-34-23-29(24-36-28-17-14-13-15-18-28)38-32(8,9)19-20-35-26(4)30(33)21-25(3)37-31(5,6)7/h13-15,17-18,25,27,29,33H,4,10-12,16,19-24H2,1-3,5-9H3/b33-30+ |
| InChIKey | DOZNFLBVIOEWJI-KKYHWDRJSA-N |
| XLogP | 8.00 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.79 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|