C82H100N2O6 — CID 102199896
1,2-bis[4-[4-[4-(2-ethylhexoxy)-N-[4-(2-ethylhexoxy)phenyl]anilino]phenyl]phenyl]ethane-1,2-dione (PubChem CID 102199896) has the molecular formula C82H100N2O6 and a molecular weight of 1209.71 g/mol. Its IUPAC name is 1,2-bis[4-[4-[4-(2-ethylhexoxy)-N-[4-(2-ethylhexoxy)phenyl]anilino]phenyl]phenyl]ethane-1,2-dione.
| Compound Name | 1,2-bis[4-[4-[4-(2-ethylhexoxy)-N-[4-(2-ethylhexoxy)phenyl]anilino]phenyl]phenyl]ethane-1,2-dione |
|---|---|
| PubChem CID | 102199896 |
| Molecular Formula | C82H100N2O6 |
| Molecular Weight | 1209.71 g/mol |
| Exact Mass | 1208.76 |
| IUPAC Name | 1,2-bis[4-[4-[4-(2-ethylhexoxy)-N-[4-(2-ethylhexoxy)phenyl]anilino]phenyl]phenyl]ethane-1,2-dione |
| SMILES | CCCCC(CC)COc1ccc(N(c2ccc(OCC(CC)CCCC)cc2)c2ccc(-c3ccc(C(=O)C(=O)c4ccc(-c5ccc(N(c6ccc(OCC(CC)CCCC)cc6)c6ccc(OCC(CC)CCCC)cc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C82H100N2O6/c1-9-17-21-61(13-5)57-87-77-49-41-73(42-50-77)83(74-43-51-78(52-44-74)88-58-62(14-6)22-18-10-2)71-37-33-67(34-38-71)65-25-29-69(30-26-65)81(85)82(86)70-31-27-66(28-32-70)68-35-39-72(40-36-68)84(75-45-53-79(54-46-75)89-59-63(15-7)23-19-11-3)76-47-55-80(56-48-76)90-60-64(16-8)24-20-12-4/h25-56,61-64H,9-24,57-60H2,1-8H3 |
| InChIKey | OQPPXYHQIKTBLW-UHFFFAOYSA-N |
| XLogP | 23.41 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1209.71 |
| LogP ≤ 5 | 23.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|