C75H94O5 — CID 87321232
3,5-bis[3,5-bis[4-(2-ethylhexoxy)phenyl]phenyl]benzaldehyde (PubChem CID 87321232) has the molecular formula C75H94O5 and a molecular weight of 1075.57 g/mol. Its IUPAC name is 3,5-bis[3,5-bis[4-(2-ethylhexoxy)phenyl]phenyl]benzaldehyde.
| Compound Name | 3,5-bis[3,5-bis[4-(2-ethylhexoxy)phenyl]phenyl]benzaldehyde |
|---|---|
| PubChem CID | 87321232 |
| Molecular Formula | C75H94O5 |
| Molecular Weight | 1075.57 g/mol |
| Exact Mass | 1074.71 |
| IUPAC Name | 3,5-bis[3,5-bis[4-(2-ethylhexoxy)phenyl]phenyl]benzaldehyde |
| SMILES | CCCCC(CC)COc1ccc(-c2cc(-c3ccc(OCC(CC)CCCC)cc3)cc(-c3cc(C=O)cc(-c4cc(-c5ccc(OCC(CC)CCCC)cc5)cc(-c5ccc(OCC(CC)CCCC)cc5)c4)c3)c2)cc1 |
| InChI | InChI=1S/C75H94O5/c1-9-17-21-55(13-5)51-77-72-33-25-60(26-34-72)66-44-67(61-27-35-73(36-28-61)78-52-56(14-6)22-18-10-2)47-70(46-66)64-41-59(50-76)42-65(43-64)71-48-68(62-29-37-74(38-30-62)79-53-57(15-7)23-19-11-3)45-69(49-71)63-31-39-75(40-32-63)80-54-58(16-8)24-20-12-4/h25-50,55-58H,9-24,51-54H2,1-8H3 |
| InChIKey | UIOJTEBGJFSTLZ-UHFFFAOYSA-N |
| XLogP | 21.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1075.57 |
| LogP ≤ 5 | 21.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|