C59H71NO2 — CID 175023471
4-[7-[3,5-bis[4-(2-ethylhexoxy)phenyl]phenyl]-9,9-dipropylfluoren-2-yl]aniline (PubChem CID 175023471) has the molecular formula C59H71NO2 and a molecular weight of 826.22 g/mol. Its IUPAC name is 4-[7-[3,5-bis[4-(2-ethylhexoxy)phenyl]phenyl]-9,9-dipropylfluoren-2-yl]aniline.
| Compound Name | 4-[7-[3,5-bis[4-(2-ethylhexoxy)phenyl]phenyl]-9,9-dipropylfluoren-2-yl]aniline |
|---|---|
| PubChem CID | 175023471 |
| Molecular Formula | C59H71NO2 |
| Molecular Weight | 826.22 g/mol |
| Exact Mass | 825.55 |
| IUPAC Name | 4-[7-[3,5-bis[4-(2-ethylhexoxy)phenyl]phenyl]-9,9-dipropylfluoren-2-yl]aniline |
| SMILES | CCCCC(CC)COc1ccc(-c2cc(-c3ccc(OCC(CC)CCCC)cc3)cc(-c3ccc4c(c3)C(CCC)(CCC)c3cc(-c5ccc(N)cc5)ccc3-4)c2)cc1 |
| InChI | InChI=1S/C59H71NO2/c1-7-13-15-42(11-5)40-61-53-27-19-45(20-28-53)49-35-50(46-21-29-54(30-22-46)62-41-43(12-6)16-14-8-2)37-51(36-49)48-24-32-56-55-31-23-47(44-17-25-52(60)26-18-44)38-57(55)59(33-9-3,34-10-4)58(56)39-48/h17-32,35-39,42-43H,7-16,33-34,40-41,60H2,1-6H3 |
| InChIKey | XOPFTZLRCLTICU-UHFFFAOYSA-N |
| XLogP | 16.99 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.22 |
| LogP ≤ 5 | 16.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|