C71H88N2O2S3 — CID 102165525
5-[5-(9,9-dioctylfluoren-2-yl)thiophen-2-yl]-2,3-bis[4-(2-ethylhexoxy)phenyl]-7-thiophen-2-ylthieno[3,4-b]pyrazine (PubChem CID 102165525) has the molecular formula C71H88N2O2S3 and a molecular weight of 1097.70 g/mol. Its IUPAC name is 5-[5-(9,9-dioctylfluoren-2-yl)thiophen-2-yl]-2,3-bis[4-(2-ethylhexoxy)phenyl]-7-thiophen-2-ylthieno[3,4-b]pyrazine.
| Compound Name | 5-[5-(9,9-dioctylfluoren-2-yl)thiophen-2-yl]-2,3-bis[4-(2-ethylhexoxy)phenyl]-7-thiophen-2-ylthieno[3,4-b]pyrazine |
|---|---|
| PubChem CID | 102165525 |
| Molecular Formula | C71H88N2O2S3 |
| Molecular Weight | 1097.70 g/mol |
| Exact Mass | 1096.60 |
| IUPAC Name | 5-[5-(9,9-dioctylfluoren-2-yl)thiophen-2-yl]-2,3-bis[4-(2-ethylhexoxy)phenyl]-7-thiophen-2-ylthieno[3,4-b]pyrazine |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2ccccc2-c2ccc(-c3ccc(-c4sc(-c5cccs5)c5nc(-c6ccc(OCC(CC)CCCC)cc6)c(-c6ccc(OCC(CC)CCCC)cc6)nc45)s3)cc21 |
| InChI | InChI=1S/C71H88N2O2S3/c1-7-13-17-19-21-25-45-71(46-26-22-20-18-14-8-2)60-31-24-23-30-58(60)59-42-37-55(48-61(59)71)62-43-44-64(77-62)70-68-67(69(78-70)63-32-27-47-76-63)72-65(53-33-38-56(39-34-53)74-49-51(11-5)28-15-9-3)66(73-68)54-35-40-57(41-36-54)75-50-52(12-6)29-16-10-4/h23-24,27,30-44,47-48,51-52H,7-22,25-26,28-29,45-46,49-50H2,1-6H3 |
| InChIKey | ABRZWQDNVMVYEW-UHFFFAOYSA-N |
| XLogP | 23.11 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1097.70 |
| LogP ≤ 5 | 23.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|