C61H64F2N2O2S2 — CID 58500549
6,7-difluoro-2,3-bis(4-methoxyphenyl)-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)quinoxaline (PubChem CID 58500549) has the molecular formula C61H64F2N2O2S2 and a molecular weight of 959.32 g/mol. Its IUPAC name is 6,7-difluoro-2,3-bis(4-methoxyphenyl)-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)quinoxaline.
| Compound Name | 6,7-difluoro-2,3-bis(4-methoxyphenyl)-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)quinoxaline |
|---|---|
| PubChem CID | 58500549 |
| Molecular Formula | C61H64F2N2O2S2 |
| Molecular Weight | 959.32 g/mol |
| Exact Mass | 958.44 |
| IUPAC Name | 6,7-difluoro-2,3-bis(4-methoxyphenyl)-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)quinoxaline |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2ccc(-c3ccc(-c4c(F)c(F)c(-c5ccc(C)s5)c5nc(-c6ccc(OC)cc6)c(-c6ccc(OC)cc6)nc45)s3)cc21 |
| InChI | InChI=1S/C61H64F2N2O2S2/c1-7-9-11-13-15-17-35-61(36-18-16-14-12-10-8-2)48-37-39(3)19-30-46(48)47-31-25-43(38-49(47)61)50-33-34-52(69-50)54-56(63)55(62)53(51-32-20-40(4)68-51)59-60(54)65-58(42-23-28-45(67-6)29-24-42)57(64-59)41-21-26-44(66-5)27-22-41/h19-34,37-38H,7-18,35-36H2,1-6H3 |
| InChIKey | XQUMYPONPUHMDJ-UHFFFAOYSA-N |
| XLogP | 18.77 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.32 |
| LogP ≤ 5 | 18.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|