C49H59F2N3S2 — CID 90211069
4-[5-(9,9-dihexyl-7-methylfluoren-2-yl)thiophen-2-yl]-5,6-difluoro-7-(5-methylthiophen-2-yl)-2-octylbenzotriazole (PubChem CID 90211069) has the molecular formula C49H59F2N3S2 and a molecular weight of 792.16 g/mol. Its IUPAC name is 4-[5-(9,9-dihexyl-7-methylfluoren-2-yl)thiophen-2-yl]-5,6-difluoro-7-(5-methylthiophen-2-yl)-2-octylbenzotriazole.
| Compound Name | 4-[5-(9,9-dihexyl-7-methylfluoren-2-yl)thiophen-2-yl]-5,6-difluoro-7-(5-methylthiophen-2-yl)-2-octylbenzotriazole |
|---|---|
| PubChem CID | 90211069 |
| Molecular Formula | C49H59F2N3S2 |
| Molecular Weight | 792.16 g/mol |
| Exact Mass | 791.41 |
| IUPAC Name | 4-[5-(9,9-dihexyl-7-methylfluoren-2-yl)thiophen-2-yl]-5,6-difluoro-7-(5-methylthiophen-2-yl)-2-octylbenzotriazole |
| SMILES | CCCCCCCCn1nc2c(-c3ccc(C)s3)c(F)c(F)c(-c3ccc(-c4ccc5c(c4)C(CCCCCC)(CCCCCC)c4cc(C)ccc4-5)s3)c2n1 |
| InChI | InChI=1S/C49H59F2N3S2/c1-6-9-12-15-16-19-30-54-52-47-43(41-25-21-34(5)55-41)45(50)46(51)44(48(47)53-54)42-27-26-40(56-42)35-22-24-37-36-23-20-33(4)31-38(36)49(39(37)32-35,28-17-13-10-7-2)29-18-14-11-8-3/h20-27,31-32H,6-19,28-30H2,1-5H3 |
| InChIKey | NAMLAXRLWPCILS-UHFFFAOYSA-N |
| XLogP | 16.02 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.16 |
| LogP ≤ 5 | 16.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|