C57H74N2S2 — CID 58500683
5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-dipentylquinoxaline (PubChem CID 58500683) has the molecular formula C57H74N2S2 and a molecular weight of 851.37 g/mol. Its IUPAC name is 5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-dipentylquinoxaline.
| Compound Name | 5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-dipentylquinoxaline |
|---|---|
| PubChem CID | 58500683 |
| Molecular Formula | C57H74N2S2 |
| Molecular Weight | 851.37 g/mol |
| Exact Mass | 850.53 |
| IUPAC Name | 5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-dipentylquinoxaline |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2ccc(-c3ccc(-c4ccc(-c5ccc(C)s5)c5nc(CCCCC)c(CCCCC)nc45)s3)cc21 |
| InChI | InChI=1S/C57H74N2S2/c1-7-11-15-17-19-23-37-57(38-24-20-18-16-12-8-2)48-39-41(5)27-30-44(48)45-31-29-43(40-49(45)57)52-35-36-54(61-52)47-33-32-46(53-34-28-42(6)60-53)55-56(47)59-51(26-22-14-10-4)50(58-55)25-21-13-9-3/h27-36,39-40H,7-26,37-38H2,1-6H3 |
| InChIKey | PDDNCAGPLVEFEF-UHFFFAOYSA-N |
| XLogP | 18.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.37 |
| LogP ≤ 5 | 18.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|