C99H130 — CID 101111092
2,7-bis[4-[9,9-bis(2-ethylhexyl)fluoren-2-yl]phenyl]-9,9-bis(2-ethylhexyl)fluorene (PubChem CID 101111092) has the molecular formula C99H130 and a molecular weight of 1320.13 g/mol. Its IUPAC name is 2,7-bis[4-[9,9-bis(2-ethylhexyl)fluoren-2-yl]phenyl]-9,9-bis(2-ethylhexyl)fluorene.
| Compound Name | 2,7-bis[4-[9,9-bis(2-ethylhexyl)fluoren-2-yl]phenyl]-9,9-bis(2-ethylhexyl)fluorene |
|---|---|
| PubChem CID | 101111092 |
| Molecular Formula | C99H130 |
| Molecular Weight | 1320.13 g/mol |
| Exact Mass | 1319.02 |
| IUPAC Name | 2,7-bis[4-[9,9-bis(2-ethylhexyl)fluoren-2-yl]phenyl]-9,9-bis(2-ethylhexyl)fluorene |
| SMILES | CCCCC(CC)CC1(CC(CC)CCCC)c2ccccc2-c2ccc(-c3ccc(-c4ccc5c(c4)C(CC(CC)CCCC)(CC(CC)CCCC)c4cc(-c6ccc(-c7ccc8c(c7)C(CC(CC)CCCC)(CC(CC)CCCC)c7ccccc7-8)cc6)ccc4-5)cc3)cc21 |
| InChI | InChI=1S/C99H130/c1-13-25-35-71(19-7)65-97(66-72(20-8)36-26-14-2)91-43-33-31-41-85(91)87-57-53-81(61-93(87)97)77-45-49-79(50-46-77)83-55-59-89-90-60-56-84(64-96(90)99(95(89)63-83,69-75(23-11)39-29-17-5)70-76(24-12)40-30-18-6)80-51-47-78(48-52-80)82-54-58-88-86-42-32-34-44-92(86)98(94(88)62-82,67-73(21-9)37-27-15-3)68-74(22-10)38-28-16-4/h31-34,41-64,71-76H,13-30,35-40,65-70H2,1-12H3 |
| InChIKey | VWDAEWZQHSKTPC-UHFFFAOYSA-N |
| XLogP | 30.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 40 |
| Heavy Atoms | 99 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1320.13 |
| LogP ≤ 5 | 30.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |