C55H58O2 — CID 71131328
[4-[7-(4-benzoylphenyl)-9,9-bis(2-ethylhexyl)fluoren-2-yl]phenyl]-phenylmethanone (PubChem CID 71131328) has the molecular formula C55H58O2 and a molecular weight of 751.07 g/mol. Its IUPAC name is [4-[7-(4-benzoylphenyl)-9,9-bis(2-ethylhexyl)fluoren-2-yl]phenyl]-phenylmethanone.
| Compound Name | [4-[7-(4-benzoylphenyl)-9,9-bis(2-ethylhexyl)fluoren-2-yl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 71131328 |
| Molecular Formula | C55H58O2 |
| Molecular Weight | 751.07 g/mol |
| Exact Mass | 750.44 |
| IUPAC Name | [4-[7-(4-benzoylphenyl)-9,9-bis(2-ethylhexyl)fluoren-2-yl]phenyl]-phenylmethanone |
| SMILES | CCCCC(CC)CC1(CC(CC)CCCC)c2cc(-c3ccc(C(=O)c4ccccc4)cc3)ccc2-c2ccc(-c3ccc(C(=O)c4ccccc4)cc3)cc21 |
| InChI | InChI=1S/C55H58O2/c1-5-9-17-39(7-3)37-55(38-40(8-4)18-10-6-2)51-35-47(41-23-27-45(28-24-41)53(56)43-19-13-11-14-20-43)31-33-49(51)50-34-32-48(36-52(50)55)42-25-29-46(30-26-42)54(57)44-21-15-12-16-22-44/h11-16,19-36,39-40H,5-10,17-18,37-38H2,1-4H3 |
| InChIKey | DGLFKIBBDQNYSE-UHFFFAOYSA-N |
| XLogP | 14.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.07 |
| LogP ≤ 5 | 14.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |