C114H141N3 — CID 102358497
2,4,6-tris[4-[(E)-2-[9,9-bis(2-ethylhexyl)fluoren-2-yl]ethenyl]phenyl]-1,3,5-triazine (PubChem CID 102358497) has the molecular formula C114H141N3 and a molecular weight of 1553.40 g/mol. Its IUPAC name is 2,4,6-tris[4-[(E)-2-[9,9-bis(2-ethylhexyl)fluoren-2-yl]ethenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[4-[(E)-2-[9,9-bis(2-ethylhexyl)fluoren-2-yl]ethenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 102358497 |
| Molecular Formula | C114H141N3 |
| Molecular Weight | 1553.40 g/mol |
| Exact Mass | 1552.11 |
| IUPAC Name | 2,4,6-tris[4-[(E)-2-[9,9-bis(2-ethylhexyl)fluoren-2-yl]ethenyl]phenyl]-1,3,5-triazine |
| SMILES | CCCCC(CC)CC1(CC(CC)CCCC)c2ccccc2-c2ccc(/C=C/c3ccc(-c4nc(-c5ccc(/C=C/c6ccc7c(c6)C(CC(CC)CCCC)(CC(CC)CCCC)c6ccccc6-7)cc5)nc(-c5ccc(/C=C/c6ccc7c(c6)C(CC(CC)CCCC)(CC(CC)CCCC)c6ccccc6-7)cc5)n4)cc3)cc21 |
| InChI | InChI=1S/C114H141N3/c1-13-25-37-82(19-7)76-112(77-83(20-8)38-26-14-2)103-46-34-31-43-97(103)100-70-61-91(73-106(100)112)52-49-88-55-64-94(65-56-88)109-115-110(95-66-57-89(58-67-95)50-53-92-62-71-101-98-44-32-35-47-104(98)113(107(101)74-92,78-84(21-9)39-27-15-3)79-85(22-10)40-28-16-4)117-111(116-109)96-68-59-90(60-69-96)51-54-93-63-72-102-99-45-33-36-48-105(99)114(108(102)75-93,80-86(23-11)41-29-17-5)81-87(24-12)42-30-18-6/h31-36,43-75,82-87H,13-30,37-42,76-81H2,1-12H3/b52-49+,53-50+,54-51+ |
| InChIKey | LPGHOYGABRXMMX-WSUSHDEBSA-N |
| XLogP | 33.82 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 117 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1553.40 |
| LogP ≤ 5 | 33.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|