C47H58S2 — CID 58906047
9,9-bis(2-ethylhexyl)-2,7-bis[(E)-2-(4-methylsulfanylphenyl)ethenyl]fluorene (PubChem CID 58906047) has the molecular formula C47H58S2 and a molecular weight of 687.12 g/mol. Its IUPAC name is 9,9-bis(2-ethylhexyl)-2,7-bis[(E)-2-(4-methylsulfanylphenyl)ethenyl]fluorene.
| Compound Name | 9,9-bis(2-ethylhexyl)-2,7-bis[(E)-2-(4-methylsulfanylphenyl)ethenyl]fluorene |
|---|---|
| PubChem CID | 58906047 |
| Molecular Formula | C47H58S2 |
| Molecular Weight | 687.12 g/mol |
| Exact Mass | 686.40 |
| IUPAC Name | 9,9-bis(2-ethylhexyl)-2,7-bis[(E)-2-(4-methylsulfanylphenyl)ethenyl]fluorene |
| SMILES | CCCCC(CC)CC1(CC(CC)CCCC)c2cc(/C=C/c3ccc(SC)cc3)ccc2-c2ccc(/C=C/c3ccc(SC)cc3)cc21 |
| InChI | InChI=1S/C47H58S2/c1-7-11-13-35(9-3)33-47(34-36(10-4)14-12-8-2)45-31-39(17-15-37-19-25-41(48-5)26-20-37)23-29-43(45)44-30-24-40(32-46(44)47)18-16-38-21-27-42(49-6)28-22-38/h15-32,35-36H,7-14,33-34H2,1-6H3/b17-15+,18-16+ |
| InChIKey | FPPQKJYCHHOQCY-YTEMWHBBSA-N |
| XLogP | 14.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.12 |
| LogP ≤ 5 | 14.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|