C39H42 — CID 122221081
9,9-dibutyl-2,7-bis[(E)-2-(4-methylphenyl)ethenyl]fluorene (PubChem CID 122221081) has the molecular formula C39H42 and a molecular weight of 510.77 g/mol. Its IUPAC name is 9,9-dibutyl-2,7-bis[(E)-2-(4-methylphenyl)ethenyl]fluorene.
| Compound Name | 9,9-dibutyl-2,7-bis[(E)-2-(4-methylphenyl)ethenyl]fluorene |
|---|---|
| PubChem CID | 122221081 |
| Molecular Formula | C39H42 |
| Molecular Weight | 510.77 g/mol |
| Exact Mass | 510.33 |
| IUPAC Name | 9,9-dibutyl-2,7-bis[(E)-2-(4-methylphenyl)ethenyl]fluorene |
| SMILES | CCCCC1(CCCC)c2cc(/C=C/c3ccc(C)cc3)ccc2-c2ccc(/C=C/c3ccc(C)cc3)cc21 |
| InChI | InChI=1S/C39H42/c1-5-7-25-39(26-8-6-2)37-27-33(19-17-31-13-9-29(3)10-14-31)21-23-35(37)36-24-22-34(28-38(36)39)20-18-32-15-11-30(4)12-16-32/h9-24,27-28H,5-8,25-26H2,1-4H3/b19-17+,20-18+ |
| InChIKey | RSAOQNBQHCMULS-XPWSMXQVSA-N |
| XLogP | 11.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.77 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|